About 3-aminopent-2-enenitrile
3-aminopent-2-enenitrile (PubChem CID 71409757) has the molecular formula C5H8N2
and a molecular weight of 96.13 g/mol. Its IUPAC name is 3-aminopent-2-enenitrile.
Molecular Properties
| Compound Name | 3-aminopent-2-enenitrile |
| PubChem CID | 71409757 |
| Molecular Formula | C5H8N2 |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.07 |
| IUPAC Name | 3-aminopent-2-enenitrile |
| SMILES | CCC(N)=CC#N |
| InChI | InChI=1S/C5H8N2/c1-2-5(7)3-4-6/h3H,2,7H2,1H3 |
| InChIKey | TVOQXZXCTSAZQF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopent-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopent-2-enenitrile?
The IUPAC name of 3-aminopent-2-enenitrile (CID 71409757) is 3-aminopent-2-enenitrile.
What is the SMILES notation for 3-aminopent-2-enenitrile?
The canonical SMILES for 3-aminopent-2-enenitrile is CCC(N)=CC#N.
What is the InChIKey of 3-aminopent-2-enenitrile?
The InChIKey is TVOQXZXCTSAZQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2/c1-2-5(7)3-4-6/h3H,2,7H2,1H3.
What are the key properties of 3-aminopent-2-enenitrile?
3-aminopent-2-enenitrile has a molecular weight of 96.13 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopent-2-enenitrile is sourced from PubChem (CID 71409757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).