C17H15NO2 — CID 71409766
(4S,5R)-5-methyl-2,2-diphenyl-1,3-dioxolane-4-carbonitrile (PubChem CID 71409766) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is (4S,5R)-5-methyl-2,2-diphenyl-1,3-dioxolane-4-carbonitrile.
| Compound Name | (4S,5R)-5-methyl-2,2-diphenyl-1,3-dioxolane-4-carbonitrile |
|---|---|
| PubChem CID | 71409766 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (4S,5R)-5-methyl-2,2-diphenyl-1,3-dioxolane-4-carbonitrile |
| SMILES | C[C@H]1OC(c2ccccc2)(c2ccccc2)O[C@H]1C#N |
| InChI | InChI=1S/C17H15NO2/c1-13-16(12-18)20-17(19-13,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,13,16H,1H3/t13-,16+/m1/s1 |
| InChIKey | XWZFQKOGRCLJIQ-CJNGLKHVSA-N |
| XLogP | 3.22 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |