About 4-arsonobenzenediazonium bromide
4-arsonobenzenediazonium bromide (PubChem CID 71410005) has the molecular formula C6H6AsBrN2O3
and a molecular weight of 308.95 g/mol. Its IUPAC name is 4-arsonobenzenediazonium bromide.
Molecular Properties
| Compound Name | 4-arsonobenzenediazonium bromide |
| PubChem CID | 71410005 |
| Molecular Formula | C6H6AsBrN2O3 |
| Molecular Weight | 308.95 g/mol |
| Exact Mass | 307.88 |
| IUPAC Name | 4-arsonobenzenediazonium bromide |
| SMILES | N#[N+]c1ccc([As](=O)(O)O)cc1.[Br-] |
| InChI | InChI=1S/C6H5AsN2O3.BrH/c8-9-6-3-1-5(2-4-6)7(10,11)12;/h1-4H,(H-,10,11,12);1H |
| InChIKey | HSVXNYWWQAYTSE-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.95 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-arsonobenzenediazonium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-arsonobenzenediazonium bromide?
The IUPAC name of 4-arsonobenzenediazonium bromide (CID 71410005) is 4-arsonobenzenediazonium bromide.
What is the SMILES notation for 4-arsonobenzenediazonium bromide?
The canonical SMILES for 4-arsonobenzenediazonium bromide is N#[N+]c1ccc([As](=O)(O)O)cc1.[Br-].
What is the InChIKey of 4-arsonobenzenediazonium bromide?
The InChIKey is HSVXNYWWQAYTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5AsN2O3.BrH/c8-9-6-3-1-5(2-4-6)7(10,11)12;/h1-4H,(H-,10,11,12);1H.
What are the key properties of 4-arsonobenzenediazonium bromide?
4-arsonobenzenediazonium bromide has a molecular weight of 308.95 g/mol, XLogP of -3.26, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-arsonobenzenediazonium bromide is sourced from PubChem (CID 71410005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).