About (4-diazo-3-oxobutyl)urea
(4-diazo-3-oxobutyl)urea (PubChem CID 71410069) has the molecular formula C5H8N4O2
and a molecular weight of 156.15 g/mol. Its IUPAC name is (4-diazo-3-oxobutyl)urea.
Molecular Properties
| Compound Name | (4-diazo-3-oxobutyl)urea |
| PubChem CID | 71410069 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (4-diazo-3-oxobutyl)urea |
| SMILES | [N-]=[N+]=CC(=O)CCNC(N)=O |
| InChI | InChI=1S/C5H8N4O2/c6-5(11)8-2-1-4(10)3-9-7/h3H,1-2H2,(H3,6,8,11) |
| InChIKey | QIOWTAJSXZSPDL-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (4-diazo-3-oxobutyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-diazo-3-oxobutyl)urea?
The IUPAC name of (4-diazo-3-oxobutyl)urea (CID 71410069) is (4-diazo-3-oxobutyl)urea.
What is the SMILES notation for (4-diazo-3-oxobutyl)urea?
The canonical SMILES for (4-diazo-3-oxobutyl)urea is [N-]=[N+]=CC(=O)CCNC(N)=O.
What is the InChIKey of (4-diazo-3-oxobutyl)urea?
The InChIKey is QIOWTAJSXZSPDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2/c6-5(11)8-2-1-4(10)3-9-7/h3H,1-2H2,(H3,6,8,11).
What are the key properties of (4-diazo-3-oxobutyl)urea?
(4-diazo-3-oxobutyl)urea has a molecular weight of 156.15 g/mol, XLogP of -1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-diazo-3-oxobutyl)urea is sourced from PubChem (CID 71410069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).