C21H28O3 — CID 71410284
2-(1-hydroxypropylidene)-5-(2,4,6-triethylphenyl)cyclohexane-1,3-dione (PubChem CID 71410284) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 2-(1-hydroxypropylidene)-5-(2,4,6-triethylphenyl)cyclohexane-1,3-dione.
| Compound Name | 2-(1-hydroxypropylidene)-5-(2,4,6-triethylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 71410284 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-(1-hydroxypropylidene)-5-(2,4,6-triethylphenyl)cyclohexane-1,3-dione |
| SMILES | CCC(O)=C1C(=O)CC(c2c(CC)cc(CC)cc2CC)CC1=O |
| InChI | InChI=1S/C21H28O3/c1-5-13-9-14(6-2)20(15(7-3)10-13)16-11-18(23)21(17(22)8-4)19(24)12-16/h9-10,16,22H,5-8,11-12H2,1-4H3/b21-17- |
| InChIKey | IZLYGCPVHDOFAE-FXBPSFAMSA-N |
| XLogP | 4.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|