About 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one
2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one (PubChem CID 71410791) has the molecular formula C11H17N5O
and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one.
Molecular Properties
| Compound Name | 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one |
| PubChem CID | 71410791 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one |
| SMILES | CC1N=c2nc(N(C)C)n(C)c(=O)c2=NC1C |
| InChI | InChI=1S/C11H17N5O/c1-6-7(2)13-9-8(12-6)10(17)16(5)11(14-9)15(3)4/h6-7H,1-5H3 |
| InChIKey | RPPNOQUQTBYTCW-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 62.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one?
The IUPAC name of 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one (CID 71410791) is 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one.
What is the SMILES notation for 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one?
The canonical SMILES for 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one is CC1N=c2nc(N(C)C)n(C)c(=O)c2=NC1C.
What is the InChIKey of 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one?
The InChIKey is RPPNOQUQTBYTCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O/c1-6-7(2)13-9-8(12-6)10(17)16(5)11(14-9)15(3)4/h6-7H,1-5H3.
What are the key properties of 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one?
2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one has a molecular weight of 235.29 g/mol, XLogP of -1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-3,6,7-trimethyl-6,7-dihydropteridin-4-one is sourced from PubChem (CID 71410791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).