C27H27N9 — CID 71410872
2,4,6-tris[(3-methylphenyl)diazenyl]benzene-1,3,5-triamine (PubChem CID 71410872) has the molecular formula C27H27N9 and a molecular weight of 477.58 g/mol. Its IUPAC name is 2,4,6-tris[(3-methylphenyl)diazenyl]benzene-1,3,5-triamine.
| Compound Name | 2,4,6-tris[(3-methylphenyl)diazenyl]benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 71410872 |
| Molecular Formula | C27H27N9 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 2,4,6-tris[(3-methylphenyl)diazenyl]benzene-1,3,5-triamine |
| SMILES | Cc1cccc(/N=N/c2c(N)c(/N=N/c3cccc(C)c3)c(N)c(/N=N/c3cccc(C)c3)c2N)c1 |
| InChI | InChI=1S/C27H27N9/c1-16-7-4-10-19(13-16)31-34-25-22(28)26(35-32-20-11-5-8-17(2)14-20)24(30)27(23(25)29)36-33-21-12-6-9-18(3)15-21/h4-15H,28-30H2,1-3H3/b34-31+,35-32+,36-33+ |
| InChIKey | ZUXNUEZFUXHLEI-JCLOTSFOSA-N |
| XLogP | 8.60 |
| TPSA | 152.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|