About 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane
8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane (PubChem CID 71411324) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane |
| PubChem CID | 71411324 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane |
| SMILES | COC1C(C)C2CC1C1CC(C)CC21 |
| InChI | InChI=1S/C13H22O/c1-7-4-10-9-6-12(11(10)5-7)13(14-3)8(9)2/h7-13H,4-6H2,1-3H3 |
| InChIKey | CSUIQMUCOODNMJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane?
The IUPAC name of 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane (CID 71411324) is 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane?
The canonical SMILES for 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane is COC1C(C)C2CC1C1CC(C)CC21.
What is the InChIKey of 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane?
The InChIKey is CSUIQMUCOODNMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c1-7-4-10-9-6-12(11(10)5-7)13(14-3)8(9)2/h7-13H,4-6H2,1-3H3.
What are the key properties of 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane?
8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane has a molecular weight of 194.32 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-4,9-dimethyltricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 71411324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).