About 2,3,4-trimethoxybenzo[8]annulene-5,6-dione
2,3,4-trimethoxybenzo[8]annulene-5,6-dione (PubChem CID 71411380) has the molecular formula C15H14O5
and a molecular weight of 274.27 g/mol. Its IUPAC name is 2,3,4-trimethoxybenzo[8]annulene-5,6-dione.
Molecular Properties
| Compound Name | 2,3,4-trimethoxybenzo[8]annulene-5,6-dione |
| PubChem CID | 71411380 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2,3,4-trimethoxybenzo[8]annulene-5,6-dione |
| SMILES | COc1cc2ccccc(=O)c(=O)c2c(OC)c1OC |
| InChI | InChI=1S/C15H14O5/c1-18-11-8-9-6-4-5-7-10(16)13(17)12(9)15(20-3)14(11)19-2/h4-8H,1-3H3/b6-4-,7-5- |
| InChIKey | VARHDEIIAYNFOZ-PEPZGXQESA-N |
| XLogP | 1.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4-trimethoxybenzo[8]annulene-5,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trimethoxybenzo[8]annulene-5,6-dione?
The IUPAC name of 2,3,4-trimethoxybenzo[8]annulene-5,6-dione (CID 71411380) is 2,3,4-trimethoxybenzo[8]annulene-5,6-dione.
What is the SMILES notation for 2,3,4-trimethoxybenzo[8]annulene-5,6-dione?
The canonical SMILES for 2,3,4-trimethoxybenzo[8]annulene-5,6-dione is COc1cc2ccccc(=O)c(=O)c2c(OC)c1OC.
What is the InChIKey of 2,3,4-trimethoxybenzo[8]annulene-5,6-dione?
The InChIKey is VARHDEIIAYNFOZ-PEPZGXQESA-N. The full InChI is InChI=1S/C15H14O5/c1-18-11-8-9-6-4-5-7-10(16)13(17)12(9)15(20-3)14(11)19-2/h4-8H,1-3H3/b6-4-,7-5-.
What are the key properties of 2,3,4-trimethoxybenzo[8]annulene-5,6-dione?
2,3,4-trimethoxybenzo[8]annulene-5,6-dione has a molecular weight of 274.27 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trimethoxybenzo[8]annulene-5,6-dione is sourced from PubChem (CID 71411380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).