C7H7N3O2 — CID 71411411
3-(furan-3-yl)-2,5-dihydro-1H-1,2,4-triazin-6-one (PubChem CID 71411411) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is 3-(furan-3-yl)-2,5-dihydro-1H-1,2,4-triazin-6-one.
| Compound Name | 3-(furan-3-yl)-2,5-dihydro-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 71411411 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 3-(furan-3-yl)-2,5-dihydro-1H-1,2,4-triazin-6-one |
| SMILES | O=C1CN=C(c2ccoc2)NN1 |
| InChI | InChI=1S/C7H7N3O2/c11-6-3-8-7(10-9-6)5-1-2-12-4-5/h1-2,4H,3H2,(H,8,10)(H,9,11) |
| InChIKey | HEDUTMIGJMBYPB-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |