About octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate
octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate (PubChem CID 71411690) has the molecular formula C26H40ClNO3
and a molecular weight of 450.06 g/mol. Its IUPAC name is octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate.
Molecular Properties
| Compound Name | octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate |
| PubChem CID | 71411690 |
| Molecular Formula | C26H40ClNO3 |
| Molecular Weight | 450.06 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(=O)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H40ClNO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-31-26(30)25(29)28-24-20-18-23(27)19-21-24/h9-10,18-21H,2-8,11-17,22H2,1H3,(H,28,29) |
| InChIKey | LYUXXCYGTNEUAN-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.06 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate?
The IUPAC name of octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate (CID 71411690) is octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate.
What is the SMILES notation for octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate?
The canonical SMILES for octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate is CCCCCCCCC=CCCCCCCCCOC(=O)C(=O)Nc1ccc(Cl)cc1.
What is the InChIKey of octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate?
The InChIKey is LYUXXCYGTNEUAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H40ClNO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-31-26(30)25(29)28-24-20-18-23(27)19-21-24/h9-10,18-21H,2-8,11-17,22H2,1H3,(H,28,29).
What are the key properties of octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate?
octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate has a molecular weight of 450.06 g/mol, XLogP of 7.86, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octadec-9-enyl 2-(4-chloroanilino)-2-oxoacetate is sourced from PubChem (CID 71411690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).