About [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate
[2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate (PubChem CID 71411786) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate.
Molecular Properties
| Compound Name | [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate |
| PubChem CID | 71411786 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate |
| SMILES | CC1=C(C=CC(=O)COC=O)C(C)(C)CCC1 |
| InChI | InChI=1S/C14H20O3/c1-11-5-4-8-14(2,3)13(11)7-6-12(16)9-17-10-15/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | DQMJLEBNZUUJBI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate?
The IUPAC name of [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate (CID 71411786) is [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate.
What is the SMILES notation for [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate?
The canonical SMILES for [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate is CC1=C(C=CC(=O)COC=O)C(C)(C)CCC1.
What is the InChIKey of [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate?
The InChIKey is DQMJLEBNZUUJBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-11-5-4-8-14(2,3)13(11)7-6-12(16)9-17-10-15/h6-7,10H,4-5,8-9H2,1-3H3.
What are the key properties of [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate?
[2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate has a molecular weight of 236.31 g/mol, XLogP of 2.81, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] formate is sourced from PubChem (CID 71411786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).