About 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium
2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium (PubChem CID 71412897) has the molecular formula C16H12N2O5
and a molecular weight of 312.28 g/mol. Its IUPAC name is 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium.
Molecular Properties
| Compound Name | 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium |
| PubChem CID | 71412897 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium |
| SMILES | O=C(O)c1ccccc1[N+](=O)[O-].[O-][n+]1ccc2ccccc2c1 |
| InChI | InChI=1S/C9H7NO.C7H5NO4/c11-10-6-5-8-3-1-2-4-9(8)7-10;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-7H;1-4H,(H,9,10) |
| InChIKey | WQAFAZLIVCPPJA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium?
The IUPAC name of 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium (CID 71412897) is 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium.
What is the SMILES notation for 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium?
The canonical SMILES for 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium is O=C(O)c1ccccc1[N+](=O)[O-].[O-][n+]1ccc2ccccc2c1.
What is the InChIKey of 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium?
The InChIKey is WQAFAZLIVCPPJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C7H5NO4/c11-10-6-5-8-3-1-2-4-9(8)7-10;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-7H;1-4H,(H,9,10).
What are the key properties of 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium?
2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium has a molecular weight of 312.28 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobenzoic acid;2-oxidoisoquinolin-2-ium is sourced from PubChem (CID 71412897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).