About bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate
bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate (PubChem CID 71412975) has the molecular formula C12H4F8HgO3
and a molecular weight of 548.74 g/mol. Its IUPAC name is bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate.
Molecular Properties
| Compound Name | bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate |
| PubChem CID | 71412975 |
| Molecular Formula | C12H4F8HgO3 |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 549.97 |
| IUPAC Name | bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate |
| SMILES | O.Oc1c(F)c(F)c([Hg]c2c(F)c(F)c(O)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/2C6HF4O.Hg.H2O/c2*7-2-1-3(8)5(10)6(11)4(2)9;;/h2*11H;;1H2 |
| InChIKey | HRGOKDYZNYNRNX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate?
The IUPAC name of bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate (CID 71412975) is bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate.
What is the SMILES notation for bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate?
The canonical SMILES for bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate is O.Oc1c(F)c(F)c([Hg]c2c(F)c(F)c(O)c(F)c2F)c(F)c1F.
What is the InChIKey of bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate?
The InChIKey is HRGOKDYZNYNRNX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6HF4O.Hg.H2O/c2*7-2-1-3(8)5(10)6(11)4(2)9;;/h2*11H;;1H2.
What are the key properties of bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate?
bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate has a molecular weight of 548.74 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)mercury;hydrate is sourced from PubChem (CID 71412975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).