About 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile
2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile (PubChem CID 71413093) has the molecular formula C14H16N2O
and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile.
Molecular Properties
| Compound Name | 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile |
| PubChem CID | 71413093 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile |
| SMILES | CC(C)(C)N1OC(C#N)=CC1c1ccccc1 |
| InChI | InChI=1S/C14H16N2O/c1-14(2,3)16-13(9-12(10-15)17-16)11-7-5-4-6-8-11/h4-9,13H,1-3H3 |
| InChIKey | SNXYQRMBXIQWLA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile?
The IUPAC name of 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile (CID 71413093) is 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile.
What is the SMILES notation for 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile?
The canonical SMILES for 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile is CC(C)(C)N1OC(C#N)=CC1c1ccccc1.
What is the InChIKey of 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile?
The InChIKey is SNXYQRMBXIQWLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O/c1-14(2,3)16-13(9-12(10-15)17-16)11-7-5-4-6-8-11/h4-9,13H,1-3H3.
What are the key properties of 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile?
2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile has a molecular weight of 228.30 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3-phenyl-3H-1,2-oxazole-5-carbonitrile is sourced from PubChem (CID 71413093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).