C17H16O8 — CID 71413134
2-(4-hydroxy-3,5-dimethoxyphenyl)chromene-2,3,5,7-tetrol (PubChem CID 71413134) has the molecular formula C17H16O8 and a molecular weight of 348.31 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5-dimethoxyphenyl)chromene-2,3,5,7-tetrol.
| Compound Name | 2-(4-hydroxy-3,5-dimethoxyphenyl)chromene-2,3,5,7-tetrol |
|---|---|
| PubChem CID | 71413134 |
| Molecular Formula | C17H16O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-(4-hydroxy-3,5-dimethoxyphenyl)chromene-2,3,5,7-tetrol |
| SMILES | COc1cc(C2(O)Oc3cc(O)cc(O)c3C=C2O)cc(OC)c1O |
| InChI | InChI=1S/C17H16O8/c1-23-13-3-8(4-14(24-2)16(13)21)17(22)15(20)7-10-11(19)5-9(18)6-12(10)25-17/h3-7,18-22H,1-2H3 |
| InChIKey | AVUDJRRBHDEMSG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |