About 2-piperazin-1-yl-1,2-dihydropyrazine
2-piperazin-1-yl-1,2-dihydropyrazine (PubChem CID 71413654) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is 2-piperazin-1-yl-1,2-dihydropyrazine.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-1,2-dihydropyrazine |
| PubChem CID | 71413654 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 2-piperazin-1-yl-1,2-dihydropyrazine |
| SMILES | C1=CNC(N2CCNCC2)C=N1 |
| InChI | InChI=1S/C8H14N4/c1-2-11-8(7-10-1)12-5-3-9-4-6-12/h1-2,7-9,11H,3-6H2 |
| InChIKey | NJOGYIWOCPJSAU-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperazin-1-yl-1,2-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-1,2-dihydropyrazine?
The IUPAC name of 2-piperazin-1-yl-1,2-dihydropyrazine (CID 71413654) is 2-piperazin-1-yl-1,2-dihydropyrazine.
What is the SMILES notation for 2-piperazin-1-yl-1,2-dihydropyrazine?
The canonical SMILES for 2-piperazin-1-yl-1,2-dihydropyrazine is C1=CNC(N2CCNCC2)C=N1.
What is the InChIKey of 2-piperazin-1-yl-1,2-dihydropyrazine?
The InChIKey is NJOGYIWOCPJSAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-2-11-8(7-10-1)12-5-3-9-4-6-12/h1-2,7-9,11H,3-6H2.
What are the key properties of 2-piperazin-1-yl-1,2-dihydropyrazine?
2-piperazin-1-yl-1,2-dihydropyrazine has a molecular weight of 166.23 g/mol, XLogP of -0.64, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-1,2-dihydropyrazine is sourced from PubChem (CID 71413654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).