About (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol
(7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol (PubChem CID 71413843) has the molecular formula C8H12O2S2
and a molecular weight of 204.32 g/mol. Its IUPAC name is (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol.
Molecular Properties
| Compound Name | (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol |
| PubChem CID | 71413843 |
| Molecular Formula | C8H12O2S2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol |
| SMILES | OCC1=C[C@H](O)CC12SCCS2 |
| InChI | InChI=1S/C8H12O2S2/c9-5-6-3-7(10)4-8(6)11-1-2-12-8/h3,7,9-10H,1-2,4-5H2/t7-/m0/s1 |
| InChIKey | MWBMLDNZOTUTTJ-ZETCQYMHSA-N |
| XLogP | 0.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol?
The IUPAC name of (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol (CID 71413843) is (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol.
What is the SMILES notation for (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol?
The canonical SMILES for (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol is OCC1=C[C@H](O)CC12SCCS2.
What is the InChIKey of (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol?
The InChIKey is MWBMLDNZOTUTTJ-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H12O2S2/c9-5-6-3-7(10)4-8(6)11-1-2-12-8/h3,7,9-10H,1-2,4-5H2/t7-/m0/s1.
What are the key properties of (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol?
(7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol has a molecular weight of 204.32 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-9-(hydroxymethyl)-1,4-dithiaspiro[4.4]non-8-en-7-ol is sourced from PubChem (CID 71413843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).