C11H5F9O — CID 71414201
[1,2-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethenyl]benzene (PubChem CID 71414201) has the molecular formula C11H5F9O and a molecular weight of 324.14 g/mol. Its IUPAC name is [1,2-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethenyl]benzene.
| Compound Name | [1,2-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethenyl]benzene |
|---|---|
| PubChem CID | 71414201 |
| Molecular Formula | C11H5F9O |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | [1,2-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethenyl]benzene |
| SMILES | FC(OC(F)(F)C(F)(F)C(F)(F)F)=C(F)c1ccccc1 |
| InChI | InChI=1S/C11H5F9O/c12-7(6-4-2-1-3-5-6)8(13)21-11(19,20)9(14,15)10(16,17)18/h1-5H |
| InChIKey | FVBNTOULJJXFBP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|