About 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one
5-bromo-7H-imidazo[1,5-a]pyrazin-8-one (PubChem CID 71414471) has the molecular formula C6H4BrN3O
and a molecular weight of 214.02 g/mol. Its IUPAC name is 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one.
Molecular Properties
| Compound Name | 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one |
| PubChem CID | 71414471 |
| Molecular Formula | C6H4BrN3O |
| Molecular Weight | 214.02 g/mol |
| Exact Mass | 212.95 |
| IUPAC Name | 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one |
| SMILES | O=c1[nH]cc(Br)n2cncc12 |
| InChI | InChI=1S/C6H4BrN3O/c7-5-2-9-6(11)4-1-8-3-10(4)5/h1-3H,(H,9,11) |
| InChIKey | XVJRFSSTVUERJS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.02 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one?
The IUPAC name of 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one (CID 71414471) is 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one.
What is the SMILES notation for 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one?
The canonical SMILES for 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one is O=c1[nH]cc(Br)n2cncc12.
What is the InChIKey of 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one?
The InChIKey is XVJRFSSTVUERJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3O/c7-5-2-9-6(11)4-1-8-3-10(4)5/h1-3H,(H,9,11).
What are the key properties of 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one?
5-bromo-7H-imidazo[1,5-a]pyrazin-8-one has a molecular weight of 214.02 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-7H-imidazo[1,5-a]pyrazin-8-one is sourced from PubChem (CID 71414471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).