C17H24N2O4S — CID 71414764
(2R)-2-[[(2S)-4-methyl-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 71414764) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is (2R)-2-[[(2S)-4-methyl-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-4-methyl-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 71414764 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (2R)-2-[[(2S)-4-methyl-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CS)C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H24N2O4S/c1-11(2)8-13(18-15(20)10-24)16(21)19-14(17(22)23)9-12-6-4-3-5-7-12/h3-7,11,13-14,24H,8-10H2,1-2H3,(H,18,20)(H,19,21)(H,22,23)/t13-,14+/m0/s1 |
| InChIKey | BQXADZPBYAJPEH-UONOGXRCSA-N |
| XLogP | 1.26 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|