About (3S,4S)-3,4-diethyldioxetane
(3S,4S)-3,4-diethyldioxetane (PubChem CID 71414825) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is (3S,4S)-3,4-diethyldioxetane.
Molecular Properties
| Compound Name | (3S,4S)-3,4-diethyldioxetane |
| PubChem CID | 71414825 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | (3S,4S)-3,4-diethyldioxetane |
| SMILES | CC[C@@H]1OO[C@H]1CC |
| InChI | InChI=1S/C6H12O2/c1-3-5-6(4-2)8-7-5/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | PNBGIVLARUKXJI-WDSKDSINSA-N |
| XLogP | 1.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3,4-diethyldioxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3,4-diethyldioxetane?
The IUPAC name of (3S,4S)-3,4-diethyldioxetane (CID 71414825) is (3S,4S)-3,4-diethyldioxetane.
What is the SMILES notation for (3S,4S)-3,4-diethyldioxetane?
The canonical SMILES for (3S,4S)-3,4-diethyldioxetane is CC[C@@H]1OO[C@H]1CC.
What is the InChIKey of (3S,4S)-3,4-diethyldioxetane?
The InChIKey is PNBGIVLARUKXJI-WDSKDSINSA-N. The full InChI is InChI=1S/C6H12O2/c1-3-5-6(4-2)8-7-5/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1.
What are the key properties of (3S,4S)-3,4-diethyldioxetane?
(3S,4S)-3,4-diethyldioxetane has a molecular weight of 116.16 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3,4-diethyldioxetane is sourced from PubChem (CID 71414825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).