C21H34SSi — CID 71415265
trimethyl-[2-(3-phenylsulfanylbut-2-enyl)oct-1-enyl]silane (PubChem CID 71415265) has the molecular formula C21H34SSi and a molecular weight of 346.66 g/mol. Its IUPAC name is trimethyl-[2-(3-phenylsulfanylbut-2-enyl)oct-1-enyl]silane.
| Compound Name | trimethyl-[2-(3-phenylsulfanylbut-2-enyl)oct-1-enyl]silane |
|---|---|
| PubChem CID | 71415265 |
| Molecular Formula | C21H34SSi |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | trimethyl-[2-(3-phenylsulfanylbut-2-enyl)oct-1-enyl]silane |
| SMILES | CCCCCCC(=C[Si](C)(C)C)CC=C(C)Sc1ccccc1 |
| InChI | InChI=1S/C21H34SSi/c1-6-7-8-10-13-20(18-23(3,4)5)17-16-19(2)22-21-14-11-9-12-15-21/h9,11-12,14-16,18H,6-8,10,13,17H2,1-5H3 |
| InChIKey | RWWGERCSUJWZIN-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|