About acetic acid;2,3-dimethylpyridine
acetic acid;2,3-dimethylpyridine (PubChem CID 71415776) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is acetic acid;2,3-dimethylpyridine.
Molecular Properties
| Compound Name | acetic acid;2,3-dimethylpyridine |
| PubChem CID | 71415776 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | acetic acid;2,3-dimethylpyridine |
| SMILES | CC(=O)O.Cc1cccnc1C |
| InChI | InChI=1S/C7H9N.C2H4O2/c1-6-4-3-5-8-7(6)2;1-2(3)4/h3-5H,1-2H3;1H3,(H,3,4) |
| InChIKey | DTFOIYPZPIQJCV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;2,3-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2,3-dimethylpyridine?
The IUPAC name of acetic acid;2,3-dimethylpyridine (CID 71415776) is acetic acid;2,3-dimethylpyridine.
What is the SMILES notation for acetic acid;2,3-dimethylpyridine?
The canonical SMILES for acetic acid;2,3-dimethylpyridine is CC(=O)O.Cc1cccnc1C.
What is the InChIKey of acetic acid;2,3-dimethylpyridine?
The InChIKey is DTFOIYPZPIQJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C2H4O2/c1-6-4-3-5-8-7(6)2;1-2(3)4/h3-5H,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;2,3-dimethylpyridine?
acetic acid;2,3-dimethylpyridine has a molecular weight of 167.21 g/mol, XLogP of 1.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2,3-dimethylpyridine is sourced from PubChem (CID 71415776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).