C27H61PSi6 — CID 71415784
[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]phosphane (PubChem CID 71415784) has the molecular formula C27H61PSi6 and a molecular weight of 585.28 g/mol. Its IUPAC name is [2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]phosphane.
| Compound Name | [2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]phosphane |
|---|---|
| PubChem CID | 71415784 |
| Molecular Formula | C27H61PSi6 |
| Molecular Weight | 585.28 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | [2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]phosphane |
| SMILES | C[Si](C)(C)C(c1cc(C([Si](C)(C)C)[Si](C)(C)C)c(P)c(C([Si](C)(C)C)[Si](C)(C)C)c1)[Si](C)(C)C |
| InChI | InChI=1S/C27H61PSi6/c1-29(2,3)25(30(4,5)6)21-19-22(26(31(7,8)9)32(10,11)12)24(28)23(20-21)27(33(13,14)15)34(16,17)18/h19-20,25-27H,28H2,1-18H3 |
| InChIKey | AOFFXFPAAPTDQD-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.28 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|