About 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol
7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol (PubChem CID 71415856) has the molecular formula C14H13N3O3
and a molecular weight of 271.28 g/mol. Its IUPAC name is 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol.
Molecular Properties
| Compound Name | 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol |
| PubChem CID | 71415856 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol |
| SMILES | Cc1c(N)c([N+](=O)[O-])cc2c3cc(O)ccc3n(C)c12 |
| InChI | InChI=1S/C14H13N3O3/c1-7-13(15)12(17(19)20)6-10-9-5-8(18)3-4-11(9)16(2)14(7)10/h3-6,18H,15H2,1-2H3 |
| InChIKey | UKYZESYLQPUGPM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol?
The IUPAC name of 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol (CID 71415856) is 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol.
What is the SMILES notation for 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol?
The canonical SMILES for 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol is Cc1c(N)c([N+](=O)[O-])cc2c3cc(O)ccc3n(C)c12.
What is the InChIKey of 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol?
The InChIKey is UKYZESYLQPUGPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O3/c1-7-13(15)12(17(19)20)6-10-9-5-8(18)3-4-11(9)16(2)14(7)10/h3-6,18H,15H2,1-2H3.
What are the key properties of 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol?
7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol has a molecular weight of 271.28 g/mol, XLogP of 2.84, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-8,9-dimethyl-6-nitrocarbazol-3-ol is sourced from PubChem (CID 71415856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).