C14H10N4O4S2 — CID 71416027
3,6-bis(benzenesulfonyl)-1,2,4,5-tetrazine (PubChem CID 71416027) has the molecular formula C14H10N4O4S2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 3,6-bis(benzenesulfonyl)-1,2,4,5-tetrazine.
| Compound Name | 3,6-bis(benzenesulfonyl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 71416027 |
| Molecular Formula | C14H10N4O4S2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 3,6-bis(benzenesulfonyl)-1,2,4,5-tetrazine |
| SMILES | O=S(=O)(c1ccccc1)c1nnc(S(=O)(=O)c2ccccc2)nn1 |
| InChI | InChI=1S/C14H10N4O4S2/c19-23(20,11-7-3-1-4-8-11)13-15-17-14(18-16-13)24(21,22)12-9-5-2-6-10-12/h1-10H |
| InChIKey | BJJLLAUVSXVDST-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 119.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |