About 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane
4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane (PubChem CID 71416070) has the molecular formula C9H14S8
and a molecular weight of 378.75 g/mol. Its IUPAC name is 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane.
Molecular Properties
| Compound Name | 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane |
| PubChem CID | 71416070 |
| Molecular Formula | C9H14S8 |
| Molecular Weight | 378.75 g/mol |
| Exact Mass | 377.89 |
| IUPAC Name | 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane |
| SMILES | C1SC(SSCC2CS2)C(SSCC2CS2)S1 |
| InChI | InChI=1S/C9H14S8/c1-6(10-1)3-14-16-8-9(13-5-12-8)17-15-4-7-2-11-7/h6-9H,1-5H2 |
| InChIKey | ZMNKGKYBBDIIQW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.75 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane?
The IUPAC name of 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane (CID 71416070) is 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane.
What is the SMILES notation for 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane?
The canonical SMILES for 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane is C1SC(SSCC2CS2)C(SSCC2CS2)S1.
What is the InChIKey of 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane?
The InChIKey is ZMNKGKYBBDIIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14S8/c1-6(10-1)3-14-16-8-9(13-5-12-8)17-15-4-7-2-11-7/h6-9H,1-5H2.
What are the key properties of 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane?
4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane has a molecular weight of 378.75 g/mol, XLogP of 5.07, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(thiiran-2-ylmethyldisulfanyl)-1,3-dithiolane is sourced from PubChem (CID 71416070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).