C20H22 — CID 71416480
(6-methyl-2-phenylhepta-1,5-dien-3-yl)benzene (PubChem CID 71416480) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is (6-methyl-2-phenylhepta-1,5-dien-3-yl)benzene.
| Compound Name | (6-methyl-2-phenylhepta-1,5-dien-3-yl)benzene |
|---|---|
| PubChem CID | 71416480 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (6-methyl-2-phenylhepta-1,5-dien-3-yl)benzene |
| SMILES | C=C(c1ccccc1)C(CC=C(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H22/c1-16(2)14-15-20(19-12-8-5-9-13-19)17(3)18-10-6-4-7-11-18/h4-14,20H,3,15H2,1-2H3 |
| InChIKey | NHAYRBZKRJCZQY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|