About chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol
chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol (PubChem CID 71416689) has the molecular formula C7H11Cl3N2O
and a molecular weight of 245.54 g/mol. Its IUPAC name is chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol.
Molecular Properties
| Compound Name | chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol |
| PubChem CID | 71416689 |
| Molecular Formula | C7H11Cl3N2O |
| Molecular Weight | 245.54 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol |
| SMILES | Cc1n[nH]c(C)c1CO.ClC(Cl)Cl |
| InChI | InChI=1S/C6H10N2O.CHCl3/c1-4-6(3-9)5(2)8-7-4;2-1(3)4/h9H,3H2,1-2H3,(H,7,8);1H |
| InChIKey | QBNZFKDLAYWLDW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol?
The IUPAC name of chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol (CID 71416689) is chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol.
What is the SMILES notation for chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol?
The canonical SMILES for chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol is Cc1n[nH]c(C)c1CO.ClC(Cl)Cl.
What is the InChIKey of chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol?
The InChIKey is QBNZFKDLAYWLDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O.CHCl3/c1-4-6(3-9)5(2)8-7-4;2-1(3)4/h9H,3H2,1-2H3,(H,7,8);1H.
What are the key properties of chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol?
chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol has a molecular weight of 245.54 g/mol, XLogP of 2.51, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;(3,5-dimethyl-1H-pyrazol-4-yl)methanol is sourced from PubChem (CID 71416689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).