C16H15BrO2 — CID 71416988
(2S)-16-bromohexadec-15-en-3,5,11,13-tetrayne-1,2-diol (PubChem CID 71416988) has the molecular formula C16H15BrO2 and a molecular weight of 319.20 g/mol. Its IUPAC name is (2S)-16-bromohexadec-15-en-3,5,11,13-tetrayne-1,2-diol.
| Compound Name | (2S)-16-bromohexadec-15-en-3,5,11,13-tetrayne-1,2-diol |
|---|---|
| PubChem CID | 71416988 |
| Molecular Formula | C16H15BrO2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | (2S)-16-bromohexadec-15-en-3,5,11,13-tetrayne-1,2-diol |
| SMILES | OC[C@@H](O)C#CC#CCCCCC#CC#CC=CBr |
| InChI | InChI=1S/C16H15BrO2/c17-14-12-10-8-6-4-2-1-3-5-7-9-11-13-16(19)15-18/h12,14,16,18-19H,1-3,5,15H2/t16-/m0/s1 |
| InChIKey | XHSHGEFDZILCJI-INIZCTEOSA-N |
| XLogP | 1.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|