About 2-azido-1H-imidazole;perchloric acid
2-azido-1H-imidazole;perchloric acid (PubChem CID 71416997) has the molecular formula C3H4ClN5O4
and a molecular weight of 209.55 g/mol. Its IUPAC name is 2-azido-1H-imidazole;perchloric acid.
Molecular Properties
| Compound Name | 2-azido-1H-imidazole;perchloric acid |
| PubChem CID | 71416997 |
| Molecular Formula | C3H4ClN5O4 |
| Molecular Weight | 209.55 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | 2-azido-1H-imidazole;perchloric acid |
| SMILES | [N-]=[N+]=Nc1ncc[nH]1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C3H3N5.ClHO4/c4-8-7-3-5-1-2-6-3;2-1(3,4)5/h1-2H,(H,5,6);(H,2,3,4,5) |
| InChIKey | CJHNBYJTCYEXQW-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 166.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.55 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-1H-imidazole;perchloric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-1H-imidazole;perchloric acid?
The IUPAC name of 2-azido-1H-imidazole;perchloric acid (CID 71416997) is 2-azido-1H-imidazole;perchloric acid.
What is the SMILES notation for 2-azido-1H-imidazole;perchloric acid?
The canonical SMILES for 2-azido-1H-imidazole;perchloric acid is [N-]=[N+]=Nc1ncc[nH]1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of 2-azido-1H-imidazole;perchloric acid?
The InChIKey is CJHNBYJTCYEXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N5.ClHO4/c4-8-7-3-5-1-2-6-3;2-1(3,4)5/h1-2H,(H,5,6);(H,2,3,4,5).
What are the key properties of 2-azido-1H-imidazole;perchloric acid?
2-azido-1H-imidazole;perchloric acid has a molecular weight of 209.55 g/mol, XLogP of -2.77, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-1H-imidazole;perchloric acid is sourced from PubChem (CID 71416997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).