2-azido-1H-imidazole;perchloric acid

C3H4ClN5O4 — CID 71416997

IUPAC2-azido-1H-imidazole;perchloric acid
SMILES[N-]=[N+]=Nc1ncc[nH]1.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/C3H3N5.ClHO4/c4-8-7-3-5-1-2-6-3;2-1(3,4)5/h1-2H,(H,5,6);(H,2,3,4,5)
InChIKeyCJHNBYJTCYEXQW-UHFFFAOYSA-N
MW209.55 g/mol
LogP-2.77
Rot. Bonds1

About 2-azido-1H-imidazole;perchloric acid

2-azido-1H-imidazole;perchloric acid (PubChem CID 71416997) has the molecular formula C3H4ClN5O4 and a molecular weight of 209.55 g/mol. Its IUPAC name is 2-azido-1H-imidazole;perchloric acid.

Molecular Properties

Compound Name2-azido-1H-imidazole;perchloric acid
PubChem CID71416997
Molecular FormulaC3H4ClN5O4
Molecular Weight209.55 g/mol
Exact Mass209.00
IUPAC Name2-azido-1H-imidazole;perchloric acid
SMILES[N-]=[N+]=Nc1ncc[nH]1.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/C3H3N5.ClHO4/c4-8-7-3-5-1-2-6-3;2-1(3,4)5/h1-2H,(H,5,6);(H,2,3,4,5)
InChIKeyCJHNBYJTCYEXQW-UHFFFAOYSA-N
XLogP-2.77
TPSA166.85 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.55
LogP ≤ 5-2.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze 2-azido-1H-imidazole;perchloric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-azido-1H-imidazole;perchloric acid?
The IUPAC name of 2-azido-1H-imidazole;perchloric acid (CID 71416997) is 2-azido-1H-imidazole;perchloric acid.
What is the SMILES notation for 2-azido-1H-imidazole;perchloric acid?
The canonical SMILES for 2-azido-1H-imidazole;perchloric acid is [N-]=[N+]=Nc1ncc[nH]1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of 2-azido-1H-imidazole;perchloric acid?
The InChIKey is CJHNBYJTCYEXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N5.ClHO4/c4-8-7-3-5-1-2-6-3;2-1(3,4)5/h1-2H,(H,5,6);(H,2,3,4,5).
What are the key properties of 2-azido-1H-imidazole;perchloric acid?
2-azido-1H-imidazole;perchloric acid has a molecular weight of 209.55 g/mol, XLogP of -2.77, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-1H-imidazole;perchloric acid is sourced from PubChem (CID 71416997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).