About 3,3-difluoronon-1-en-4-yl prop-2-enoate
3,3-difluoronon-1-en-4-yl prop-2-enoate (PubChem CID 71417609) has the molecular formula C12H18F2O2
and a molecular weight of 232.27 g/mol. Its IUPAC name is 3,3-difluoronon-1-en-4-yl prop-2-enoate.
Molecular Properties
| Compound Name | 3,3-difluoronon-1-en-4-yl prop-2-enoate |
| PubChem CID | 71417609 |
| Molecular Formula | C12H18F2O2 |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 3,3-difluoronon-1-en-4-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(CCCCC)C(F)(F)C=C |
| InChI | InChI=1S/C12H18F2O2/c1-4-7-8-9-10(12(13,14)6-3)16-11(15)5-2/h5-6,10H,2-4,7-9H2,1H3 |
| InChIKey | ZRTTYAGOKSAATL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,3-difluoronon-1-en-4-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoronon-1-en-4-yl prop-2-enoate?
The IUPAC name of 3,3-difluoronon-1-en-4-yl prop-2-enoate (CID 71417609) is 3,3-difluoronon-1-en-4-yl prop-2-enoate.
What is the SMILES notation for 3,3-difluoronon-1-en-4-yl prop-2-enoate?
The canonical SMILES for 3,3-difluoronon-1-en-4-yl prop-2-enoate is C=CC(=O)OC(CCCCC)C(F)(F)C=C.
What is the InChIKey of 3,3-difluoronon-1-en-4-yl prop-2-enoate?
The InChIKey is ZRTTYAGOKSAATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2O2/c1-4-7-8-9-10(12(13,14)6-3)16-11(15)5-2/h5-6,10H,2-4,7-9H2,1H3.
What are the key properties of 3,3-difluoronon-1-en-4-yl prop-2-enoate?
3,3-difluoronon-1-en-4-yl prop-2-enoate has a molecular weight of 232.27 g/mol, XLogP of 3.49, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoronon-1-en-4-yl prop-2-enoate is sourced from PubChem (CID 71417609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).