4H-furo[3,2-b]pyrrole-5-carboxylic acid

C7H5NO3 — CID 7141881

IUPAC4H-furo[3,2-b]pyrrole-5-carboxylic acid
SMILESO=C(O)c1cc2occc2[nH]1
InChIInChI=1S/C7H5NO3/c9-7(10)5-3-6-4(8-5)1-2-11-6/h1-3,8H,(H,9,10)
InChIKeyMMAIBGHDBYQYDI-UHFFFAOYSA-N
MW151.12 g/mol
LogP1.46
Rot. Bonds1

About 4H-furo[3,2-b]pyrrole-5-carboxylic acid

4H-furo[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 7141881) has the molecular formula C7H5NO3 and a molecular weight of 151.12 g/mol. Its IUPAC name is 4H-furo[3,2-b]pyrrole-5-carboxylic acid.

Molecular Properties

Compound Name4H-furo[3,2-b]pyrrole-5-carboxylic acid
PubChem CID7141881
Molecular FormulaC7H5NO3
Molecular Weight151.12 g/mol
Exact Mass151.03
IUPAC Name4H-furo[3,2-b]pyrrole-5-carboxylic acid
SMILESO=C(O)c1cc2occc2[nH]1
InChIInChI=1S/C7H5NO3/c9-7(10)5-3-6-4(8-5)1-2-11-6/h1-3,8H,(H,9,10)
InChIKeyMMAIBGHDBYQYDI-UHFFFAOYSA-N
XLogP1.46
TPSA66.23 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.12
LogP ≤ 51.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4H-furo[3,2-b]pyrrole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 4H-furo[3,2-b]pyrrole-5-carboxylic acid (CID 7141881) is 4H-furo[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 4H-furo[3,2-b]pyrrole-5-carboxylic acid is O=C(O)c1cc2occc2[nH]1.
What is the InChIKey of 4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is MMAIBGHDBYQYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3/c9-7(10)5-3-6-4(8-5)1-2-11-6/h1-3,8H,(H,9,10).
What are the key properties of 4H-furo[3,2-b]pyrrole-5-carboxylic acid?
4H-furo[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 151.12 g/mol, XLogP of 1.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-furo[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 7141881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).