About 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid
2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 7141883) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 7141883 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | Cc1cc2[nH]c(C(=O)O)cc2o1 |
| InChI | InChI=1S/C8H7NO3/c1-4-2-5-7(12-4)3-6(9-5)8(10)11/h2-3,9H,1H3,(H,10,11) |
| InChIKey | ILLLWINWDFYWES-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid (CID 7141883) is 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is Cc1cc2[nH]c(C(=O)O)cc2o1.
What is the InChIKey of 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is ILLLWINWDFYWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c1-4-2-5-7(12-4)3-6(9-5)8(10)11/h2-3,9H,1H3,(H,10,11).
What are the key properties of 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid?
2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 165.15 g/mol, XLogP of 1.77, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 7141883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).