C7H5BrF3NO2 — CID 71418868
1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethane-1,1-diol (PubChem CID 71418868) has the molecular formula C7H5BrF3NO2 and a molecular weight of 272.02 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethane-1,1-diol.
| Compound Name | 1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 71418868 |
| Molecular Formula | C7H5BrF3NO2 |
| Molecular Weight | 272.02 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-2,2,2-trifluoroethane-1,1-diol |
| SMILES | OC(O)(c1ccc(Br)cn1)C(F)(F)F |
| InChI | InChI=1S/C7H5BrF3NO2/c8-4-1-2-5(12-3-4)6(13,14)7(9,10)11/h1-3,13-14H |
| InChIKey | ASEUKVVZAWQBOB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.02 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|