About but-3-enyl 2-hydroxypropanoate
but-3-enyl 2-hydroxypropanoate (PubChem CID 71419050) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is but-3-enyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | but-3-enyl 2-hydroxypropanoate |
| PubChem CID | 71419050 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | but-3-enyl 2-hydroxypropanoate |
| SMILES | C=CCCOC(=O)C(C)O |
| InChI | InChI=1S/C7H12O3/c1-3-4-5-10-7(9)6(2)8/h3,6,8H,1,4-5H2,2H3 |
| InChIKey | JUMWMTWQAVPKAV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 2-hydroxypropanoate?
The IUPAC name of but-3-enyl 2-hydroxypropanoate (CID 71419050) is but-3-enyl 2-hydroxypropanoate.
What is the SMILES notation for but-3-enyl 2-hydroxypropanoate?
The canonical SMILES for but-3-enyl 2-hydroxypropanoate is C=CCCOC(=O)C(C)O.
What is the InChIKey of but-3-enyl 2-hydroxypropanoate?
The InChIKey is JUMWMTWQAVPKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-3-4-5-10-7(9)6(2)8/h3,6,8H,1,4-5H2,2H3.
What are the key properties of but-3-enyl 2-hydroxypropanoate?
but-3-enyl 2-hydroxypropanoate has a molecular weight of 144.17 g/mol, XLogP of 0.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 2-hydroxypropanoate is sourced from PubChem (CID 71419050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).