About 6,9-dihydropyrazino[2,3-g]quinoxaline
6,9-dihydropyrazino[2,3-g]quinoxaline (PubChem CID 71419664) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is 6,9-dihydropyrazino[2,3-g]quinoxaline.
Molecular Properties
| Compound Name | 6,9-dihydropyrazino[2,3-g]quinoxaline |
| PubChem CID | 71419664 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 6,9-dihydropyrazino[2,3-g]quinoxaline |
| SMILES | C1=CNc2cc3nccnc3cc2N1 |
| InChI | InChI=1S/C10H8N4/c1-2-12-8-6-10-9(5-7(8)11-1)13-3-4-14-10/h1-6,11-12H |
| InChIKey | OFQGQOZLMSBPBV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,9-dihydropyrazino[2,3-g]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,9-dihydropyrazino[2,3-g]quinoxaline?
The IUPAC name of 6,9-dihydropyrazino[2,3-g]quinoxaline (CID 71419664) is 6,9-dihydropyrazino[2,3-g]quinoxaline.
What is the SMILES notation for 6,9-dihydropyrazino[2,3-g]quinoxaline?
The canonical SMILES for 6,9-dihydropyrazino[2,3-g]quinoxaline is C1=CNc2cc3nccnc3cc2N1.
What is the InChIKey of 6,9-dihydropyrazino[2,3-g]quinoxaline?
The InChIKey is OFQGQOZLMSBPBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4/c1-2-12-8-6-10-9(5-7(8)11-1)13-3-4-14-10/h1-6,11-12H.
What are the key properties of 6,9-dihydropyrazino[2,3-g]quinoxaline?
6,9-dihydropyrazino[2,3-g]quinoxaline has a molecular weight of 184.20 g/mol, XLogP of 1.94, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,9-dihydropyrazino[2,3-g]quinoxaline is sourced from PubChem (CID 71419664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).