About 4-ethenylbenzenesulfonic acid;1-ethylimidazole
4-ethenylbenzenesulfonic acid;1-ethylimidazole (PubChem CID 71420556) has the molecular formula C13H16N2O3S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-ethenylbenzenesulfonic acid;1-ethylimidazole.
Molecular Properties
| Compound Name | 4-ethenylbenzenesulfonic acid;1-ethylimidazole |
| PubChem CID | 71420556 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-ethenylbenzenesulfonic acid;1-ethylimidazole |
| SMILES | C=Cc1ccc(S(=O)(=O)O)cc1.CCn1ccnc1 |
| InChI | InChI=1S/C8H8O3S.C5H8N2/c1-2-7-3-5-8(6-4-7)12(9,10)11;1-2-7-4-3-6-5-7/h2-6H,1H2,(H,9,10,11);3-5H,2H2,1H3 |
| InChIKey | IEAXYARQLWUODY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylbenzenesulfonic acid;1-ethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylbenzenesulfonic acid;1-ethylimidazole?
The IUPAC name of 4-ethenylbenzenesulfonic acid;1-ethylimidazole (CID 71420556) is 4-ethenylbenzenesulfonic acid;1-ethylimidazole.
What is the SMILES notation for 4-ethenylbenzenesulfonic acid;1-ethylimidazole?
The canonical SMILES for 4-ethenylbenzenesulfonic acid;1-ethylimidazole is C=Cc1ccc(S(=O)(=O)O)cc1.CCn1ccnc1.
What is the InChIKey of 4-ethenylbenzenesulfonic acid;1-ethylimidazole?
The InChIKey is IEAXYARQLWUODY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3S.C5H8N2/c1-2-7-3-5-8(6-4-7)12(9,10)11;1-2-7-4-3-6-5-7/h2-6H,1H2,(H,9,10,11);3-5H,2H2,1H3.
What are the key properties of 4-ethenylbenzenesulfonic acid;1-ethylimidazole?
4-ethenylbenzenesulfonic acid;1-ethylimidazole has a molecular weight of 280.35 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylbenzenesulfonic acid;1-ethylimidazole is sourced from PubChem (CID 71420556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).