About methyl N-(1,1-difluorohex-5-en-2-yl)carbamate
methyl N-(1,1-difluorohex-5-en-2-yl)carbamate (PubChem CID 71420693) has the molecular formula C8H13F2NO2
and a molecular weight of 193.19 g/mol. Its IUPAC name is methyl N-(1,1-difluorohex-5-en-2-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(1,1-difluorohex-5-en-2-yl)carbamate |
| PubChem CID | 71420693 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | methyl N-(1,1-difluorohex-5-en-2-yl)carbamate |
| SMILES | C=CCCC(NC(=O)OC)C(F)F |
| InChI | InChI=1S/C8H13F2NO2/c1-3-4-5-6(7(9)10)11-8(12)13-2/h3,6-7H,1,4-5H2,2H3,(H,11,12) |
| InChIKey | HEGYVTJXEDINOF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(1,1-difluorohex-5-en-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(1,1-difluorohex-5-en-2-yl)carbamate?
The IUPAC name of methyl N-(1,1-difluorohex-5-en-2-yl)carbamate (CID 71420693) is methyl N-(1,1-difluorohex-5-en-2-yl)carbamate.
What is the SMILES notation for methyl N-(1,1-difluorohex-5-en-2-yl)carbamate?
The canonical SMILES for methyl N-(1,1-difluorohex-5-en-2-yl)carbamate is C=CCCC(NC(=O)OC)C(F)F.
What is the InChIKey of methyl N-(1,1-difluorohex-5-en-2-yl)carbamate?
The InChIKey is HEGYVTJXEDINOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO2/c1-3-4-5-6(7(9)10)11-8(12)13-2/h3,6-7H,1,4-5H2,2H3,(H,11,12).
What are the key properties of methyl N-(1,1-difluorohex-5-en-2-yl)carbamate?
methyl N-(1,1-difluorohex-5-en-2-yl)carbamate has a molecular weight of 193.19 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(1,1-difluorohex-5-en-2-yl)carbamate is sourced from PubChem (CID 71420693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).