C12H15F6N3O5 — CID 71421114
4-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]-4-oxobutanoic acid (PubChem CID 71421114) has the molecular formula C12H15F6N3O5 and a molecular weight of 395.26 g/mol. Its IUPAC name is 4-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71421114 |
| Molecular Formula | C12H15F6N3O5 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(CCNC(=O)C(F)(F)F)CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F6N3O5/c13-11(14,15)9(25)19-3-5-21(7(22)1-2-8(23)24)6-4-20-10(26)12(16,17)18/h1-6H2,(H,19,25)(H,20,26)(H,23,24) |
| InChIKey | OYDVGPLLVCKJKM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |