About 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one
3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one (PubChem CID 71421161) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one.
Molecular Properties
| Compound Name | 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one |
| PubChem CID | 71421161 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one |
| SMILES | O=C1OCCC2=CC=CC=CN12 |
| InChI | InChI=1S/C9H9NO2/c11-9-10-6-3-1-2-4-8(10)5-7-12-9/h1-4,6H,5,7H2 |
| InChIKey | QLCNLWUMVKKNJG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one?
The IUPAC name of 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one (CID 71421161) is 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one.
What is the SMILES notation for 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one?
The canonical SMILES for 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one is O=C1OCCC2=CC=CC=CN12.
What is the InChIKey of 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one?
The InChIKey is QLCNLWUMVKKNJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c11-9-10-6-3-1-2-4-8(10)5-7-12-9/h1-4,6H,5,7H2.
What are the key properties of 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one?
3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one has a molecular weight of 163.18 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-[1,3]oxazino[3,4-a]azepin-1-one is sourced from PubChem (CID 71421161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).