C13H11N3O3 — CID 71421175
10-ethyl-1H-pyrimido[4,5-b]quinoline-2,4,8-trione (PubChem CID 71421175) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 10-ethyl-1H-pyrimido[4,5-b]quinoline-2,4,8-trione.
| Compound Name | 10-ethyl-1H-pyrimido[4,5-b]quinoline-2,4,8-trione |
|---|---|
| PubChem CID | 71421175 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 10-ethyl-1H-pyrimido[4,5-b]quinoline-2,4,8-trione |
| SMILES | CCn1c2cc(=O)ccc-2cc2c(=O)[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C13H11N3O3/c1-2-16-10-6-8(17)4-3-7(10)5-9-11(16)14-13(19)15-12(9)18/h3-6H,2H2,1H3,(H2,14,15,18,19) |
| InChIKey | MBTIRBVOZNMJGS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|