About (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate
(2-hydroxycyclohexyl) N,N-diethylcarbamodithioate (PubChem CID 71421725) has the molecular formula C11H21NOS2
and a molecular weight of 247.43 g/mol. Its IUPAC name is (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate.
Molecular Properties
| Compound Name | (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate |
| PubChem CID | 71421725 |
| Molecular Formula | C11H21NOS2 |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC1CCCCC1O |
| InChI | InChI=1S/C11H21NOS2/c1-3-12(4-2)11(14)15-10-8-6-5-7-9(10)13/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | PPRJKUWRIIWNLO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate?
The IUPAC name of (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate (CID 71421725) is (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate.
What is the SMILES notation for (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate?
The canonical SMILES for (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate is CCN(CC)C(=S)SC1CCCCC1O.
What is the InChIKey of (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate?
The InChIKey is PPRJKUWRIIWNLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NOS2/c1-3-12(4-2)11(14)15-10-8-6-5-7-9(10)13/h9-10,13H,3-8H2,1-2H3.
What are the key properties of (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate?
(2-hydroxycyclohexyl) N,N-diethylcarbamodithioate has a molecular weight of 247.43 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxycyclohexyl) N,N-diethylcarbamodithioate is sourced from PubChem (CID 71421725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).