C9H11N3 — CID 71421802
4,5-dimethyl-3,6-dihydro-2H-pyridine-1,2-dicarbonitrile (PubChem CID 71421802) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 4,5-dimethyl-3,6-dihydro-2H-pyridine-1,2-dicarbonitrile.
| Compound Name | 4,5-dimethyl-3,6-dihydro-2H-pyridine-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 71421802 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 4,5-dimethyl-3,6-dihydro-2H-pyridine-1,2-dicarbonitrile |
| SMILES | CC1=C(C)CN(C#N)C(C#N)C1 |
| InChI | InChI=1S/C9H11N3/c1-7-3-9(4-10)12(6-11)5-8(7)2/h9H,3,5H2,1-2H3 |
| InChIKey | RZIMSYPXZRLCRE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|