C9H15BrO — CID 71422025
cis-(2R,3R)-2-bromo-3-ethylcycloheptan-1-one (PubChem CID 71422025) has the molecular formula C9H15BrO and a molecular weight of 219.12 g/mol. Its IUPAC name is cis-(2R,3R)-2-bromo-3-ethylcycloheptan-1-one.
| Compound Name | cis-(2R,3R)-2-bromo-3-ethylcycloheptan-1-one |
|---|---|
| PubChem CID | 71422025 |
| Molecular Formula | C9H15BrO |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | cis-(2R,3R)-2-bromo-3-ethylcycloheptan-1-one |
| SMILES | CC[C@@H]1CCCCC(=O)[C@@H]1Br |
| InChI | InChI=1S/C9H15BrO/c1-2-7-5-3-4-6-8(11)9(7)10/h7,9H,2-6H2,1H3/t7-,9-/m1/s1 |
| InChIKey | OTOHYKKFSMOIRH-VXNVDRBHSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|