C36H40N4O3 — CID 71422059
(2S)-4-methyl-2-[[(2S)-3-phenyl-2-[[2-(tritylamino)acetyl]amino]propanoyl]amino]pentanamide (PubChem CID 71422059) has the molecular formula C36H40N4O3 and a molecular weight of 576.74 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[(2S)-3-phenyl-2-[[2-(tritylamino)acetyl]amino]propanoyl]amino]pentanamide.
| Compound Name | (2S)-4-methyl-2-[[(2S)-3-phenyl-2-[[2-(tritylamino)acetyl]amino]propanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 71422059 |
| Molecular Formula | C36H40N4O3 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | (2S)-4-methyl-2-[[(2S)-3-phenyl-2-[[2-(tritylamino)acetyl]amino]propanoyl]amino]pentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(c1ccccc1)(c1ccccc1)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C36H40N4O3/c1-26(2)23-31(34(37)42)40-35(43)32(24-27-15-7-3-8-16-27)39-33(41)25-38-36(28-17-9-4-10-18-28,29-19-11-5-12-20-29)30-21-13-6-14-22-30/h3-22,26,31-32,38H,23-25H2,1-2H3,(H2,37,42)(H,39,41)(H,40,43)/t31-,32-/m0/s1 |
| InChIKey | VVBFVSUUHYHWTK-ACHIHNKUSA-N |
| XLogP | 4.31 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|