C9H15NO2 — CID 71422705
propyl N-penta-1,3-dienylcarbamate (PubChem CID 71422705) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is propyl N-penta-1,3-dienylcarbamate.
| Compound Name | propyl N-penta-1,3-dienylcarbamate |
|---|---|
| PubChem CID | 71422705 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | propyl N-penta-1,3-dienylcarbamate |
| SMILES | CC=CC=CNC(=O)OCCC |
| InChI | InChI=1S/C9H15NO2/c1-3-5-6-7-10-9(11)12-8-4-2/h3,5-7H,4,8H2,1-2H3,(H,10,11) |
| InChIKey | UNZLYTIAFCJWFJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|