About benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine
benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine (PubChem CID 71422770) has the molecular formula C18H16N2O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine.
Molecular Properties
| Compound Name | benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine |
| PubChem CID | 71422770 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine |
| SMILES | C(=Cc1ccncc1)c1ccncc1.Oc1ccccc1O |
| InChI | InChI=1S/C12H10N2.C6H6O2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;7-5-3-1-2-4-6(5)8/h1-10H;1-4,7-8H |
| InChIKey | CBDLJAPHALLJIT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine?
The IUPAC name of benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine (CID 71422770) is benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine.
What is the SMILES notation for benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine?
The canonical SMILES for benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine is C(=Cc1ccncc1)c1ccncc1.Oc1ccccc1O.
What is the InChIKey of benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine?
The InChIKey is CBDLJAPHALLJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2.C6H6O2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;7-5-3-1-2-4-6(5)8/h1-10H;1-4,7-8H.
What are the key properties of benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine?
benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine has a molecular weight of 292.34 g/mol, XLogP of 3.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;4-(2-pyridin-4-ylethenyl)pyridine is sourced from PubChem (CID 71422770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).