About 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline
3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline (PubChem CID 71423013) has the molecular formula C36H26N4O2
and a molecular weight of 546.63 g/mol. Its IUPAC name is 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline.
Molecular Properties
| Compound Name | 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline |
| PubChem CID | 71423013 |
| Molecular Formula | C36H26N4O2 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline |
| SMILES | COc1ccc(-c2ccc(-c3ccc4c(ccc5nc(-c6ccc(-c7ccc(OC)cc7)cn6)ccc54)n3)nc2)cc1 |
| InChI | InChI=1S/C36H26N4O2/c1-41-27-9-3-23(4-10-27)25-7-15-33(37-21-25)35-17-13-29-30-14-18-36(40-32(30)20-19-31(29)39-35)34-16-8-26(22-38-34)24-5-11-28(42-2)12-6-24/h3-22H,1-2H3 |
| InChIKey | UFKOMQSEOFMIKK-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline?
The IUPAC name of 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline (CID 71423013) is 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline.
What is the SMILES notation for 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline?
The canonical SMILES for 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline is COc1ccc(-c2ccc(-c3ccc4c(ccc5nc(-c6ccc(-c7ccc(OC)cc7)cn6)ccc54)n3)nc2)cc1.
What is the InChIKey of 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline?
The InChIKey is UFKOMQSEOFMIKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H26N4O2/c1-41-27-9-3-23(4-10-27)25-7-15-33(37-21-25)35-17-13-29-30-14-18-36(40-32(30)20-19-31(29)39-35)34-16-8-26(22-38-34)24-5-11-28(42-2)12-6-24/h3-22H,1-2H3.
What are the key properties of 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline?
3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline has a molecular weight of 546.63 g/mol, XLogP of 8.26, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-bis[5-(4-methoxyphenyl)-2-pyridinyl]-4,7-phenanthroline is sourced from PubChem (CID 71423013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).